CAS 892592-48-2
:2-methyl-2-[(thiophen-3-ylmethyl)amino]propan-1-ol
Description:
2-Methyl-2-[(thiophen-3-ylmethyl)amino]propan-1-ol is an organic compound characterized by its unique structure, which includes a propanol backbone with a methyl group and a thiophenylmethyl amino substituent. This compound features a chiral center, which may lead to the existence of enantiomers. The presence of the thiophene ring contributes to its potential aromatic properties, influencing its reactivity and interactions with other molecules. The hydroxyl group (-OH) in the propanol portion suggests that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the amino group can act as a base, allowing for protonation under acidic conditions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 2-methyl-2-[(thiophen-3-ylmethyl)amino]propan-1-ol represents a versatile structure with potential applications in various chemical and pharmaceutical fields.
Formula:C9H15NOS
InChI:InChI=1/C9H15NOS/c1-9(2,7-11)10-5-8-3-4-12-6-8/h3-4,6,10-11H,5,7H2,1-2H3
SMILES:CC(C)(CO)NCc1ccsc1
Synonyms:- 1-Propanol, 2-Methyl-2-[(3-Thienylmethyl)Amino]-
- 2-Methyl-2-[(3-thienylmethyl)amino]propan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.