CAS 892592-60-8

1-pyridin-3-yl-N-(thiophen-3-ylmethyl)methanamine

Description:

1-Pyridin-3-yl-N-(thiophen-3-ylmethyl)methanamine is an organic compound characterized by its unique structure, which includes a pyridine ring and a thiophene moiety. The presence of the pyridine ring contributes to its aromatic properties and potential for hydrogen bonding, while the thiophene ring adds to its electronic characteristics and may influence its reactivity. This compound typically exhibits moderate to high solubility in polar organic solvents due to the presence of the amine functional group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit biological activity. The amine group may also participate in various chemical reactions, such as alkylation or acylation, making it a versatile intermediate in organic synthesis. Overall, the combination of aromatic rings and functional groups in 1-pyridin-3-yl-N-(thiophen-3-ylmethyl)methanamine provides a rich platform for further chemical exploration and application.

Formula: C₁₁H₁₂N₂S

InChI: InChI=1/C11H12N2S/c1-2-10(6-12-4-1)7-13-8-11-3-5-14-9-11/h1-6,9,13H,7-8H2

SMILES: c1cc(cnc1)CNCc1ccsc1

Synonyms:

• 1-(Pyridin-3-yl)-N-(3-thienylmethyl)methanamine
• 3-pyridinemethanamine, N-(3-thienylmethyl)-