CAS 892592-66-4
:1-(tetrahydrofuran-2-yl)-N-(thiophen-3-ylmethyl)methanamine
Description:
1-(Tetrahydrofuran-2-yl)-N-(thiophen-3-ylmethyl)methanamine, identified by its CAS number 892592-66-4, is a chemical compound characterized by its unique structural features. It contains a tetrahydrofuran ring, which is a five-membered cyclic ether known for its polar aprotic properties, enhancing solubility in various organic solvents. The presence of a thiophene moiety, a five-membered aromatic ring containing sulfur, contributes to the compound's potential electronic properties and reactivity. This compound is likely to exhibit moderate to high lipophilicity due to the hydrophobic nature of the thiophene and the tetrahydrofuran ring, which may influence its biological activity and interaction with biological membranes. Additionally, the amine functional group suggests potential for hydrogen bonding, which can affect its solubility and reactivity. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, owing to its structural diversity and potential biological activity. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C10H15NOS
InChI:InChI=1/C10H15NOS/c1-2-10(12-4-1)7-11-6-9-3-5-13-8-9/h3,5,8,10-11H,1-2,4,6-7H2
SMILES:C1CC(CNCc2ccsc2)OC1
Synonyms:- 1-(Tetrahydrofuran-2-yl)-N-(3-thienylmethyl)methanamine
- 2-furanmethanamine, tetrahydro-N-(3-thienylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(Tetrahydrofuran-2-yl)-N-(thiophen-3-ylmethyl)methanamine
CAS:Formula:C10H15NOSMolecular weight:197.2972
