CAS 892592-84-6
:2-methyl-N-(thiophen-3-ylmethyl)propan-1-amine
Description:
2-Methyl-N-(thiophen-3-ylmethyl)propan-1-amine is an organic compound characterized by its amine functional group and the presence of a thiophene ring, which contributes to its unique chemical properties. The structure features a branched alkyl chain with a methyl group attached to the nitrogen atom, enhancing its steric properties. The thiophene moiety, a five-membered aromatic ring containing sulfur, imparts distinct electronic characteristics, potentially influencing the compound's reactivity and interaction with biological systems. This compound may exhibit properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and drug development. Its molecular interactions could be relevant in various applications, including pharmaceuticals, where the thiophene ring can enhance binding affinity to biological targets. Overall, the combination of the amine and thiophene functionalities suggests that this compound could participate in diverse chemical reactions and exhibit interesting pharmacological properties.
Formula:C9H15NS
InChI:InChI=1/C9H15NS/c1-8(2)5-10-6-9-3-4-11-7-9/h3-4,7-8,10H,5-6H2,1-2H3
SMILES:CC(C)CNCc1ccsc1
Synonyms:- 2-Methyl-N-(3-thienylmethyl)propan-1-amine
- 3-thiophenemethanamine, N-(2-methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
