CymitQuimica logo

CAS 892592-86-8

:

N-(thiophen-3-ylmethyl)butan-2-amine

Description:
N-(thiophen-3-ylmethyl)butan-2-amine is an organic compound characterized by its unique structure, which includes a butan-2-amine backbone and a thiophene ring substituted at the 3-position with a methyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The thiophene moiety contributes to its aromatic character, potentially influencing its electronic properties and reactivity. The presence of the butyl chain can affect its solubility and lipophilicity, making it relevant in medicinal chemistry and drug design. Compounds like this may exhibit biological activity, and their pharmacological profiles can be influenced by the specific arrangement of functional groups. As with many organic compounds, the stability, reactivity, and interactions with other molecules can vary based on environmental conditions such as pH and temperature. Overall, N-(thiophen-3-ylmethyl)butan-2-amine represents a class of compounds that may have applications in various fields, including pharmaceuticals and materials science.
Formula:C9H15NS
InChI:InChI=1/C9H15NS/c1-3-8(2)10-6-9-4-5-11-7-9/h4-5,7-8,10H,3,6H2,1-2H3
SMILES:CCC(C)NCc1ccsc1
Synonyms:
  • 3-thiophenemethanamine, N-(1-methylpropyl)-
  • N-(3-Thienylmethyl)butan-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.