CAS 892593-19-0

N-(thiophen-3-ylmethyl)cyclopropanamine

Description:

N-(thiophen-3-ylmethyl)cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropanamine moiety and a thiophene ring. The presence of the cyclopropane structure contributes to its rigidity and potential for unique reactivity, while the thiophene ring introduces aromatic characteristics and potential for π-π interactions. This compound may exhibit interesting pharmacological properties due to its ability to interact with biological targets, making it of interest in medicinal chemistry. The functional groups present in the molecule can influence its solubility, stability, and reactivity, which are critical for its application in drug development. Additionally, the specific arrangement of atoms and the presence of nitrogen in the amine group can affect its basicity and potential for forming hydrogen bonds. Overall, N-(thiophen-3-ylmethyl)cyclopropanamine represents a class of compounds that may have diverse applications in pharmaceuticals and materials science, warranting further investigation into its properties and potential uses.

Formula: C₈H₁₁NS

InChI: InChI=1/C8H11NS/c1-2-8(1)9-5-7-3-4-10-6-7/h3-4,6,8-9H,1-2,5H2

SMILES: C1CC1NCc1ccsc1

Synonyms:

• 3-thiophenemethanamine, N-cyclopropyl-
• N-(3-Thienylmethyl)cyclopropanamine

N-[(thiophen-3-yl)methyl]cyclopropanamine

CAS: 892593-19-0

Formula: C₈H₁₁NS

Molecular weight: 153.2446

Ref: IN-DA0041YY