CAS 892593-40-7
:1-furan-2-yl-N-(thiophen-3-ylmethyl)methanamine
Description:
1-Furan-2-yl-N-(thiophen-3-ylmethyl)methanamine is an organic compound characterized by the presence of a furan ring and a thiophene moiety, which contribute to its aromatic properties. The furan ring, a five-membered heterocyclic compound containing oxygen, imparts unique reactivity and stability, while the thiophene ring, a five-membered ring containing sulfur, adds to the compound's electronic properties. This compound features an amine functional group, which can participate in hydrogen bonding and may influence its solubility and reactivity. The presence of both furan and thiophene rings suggests potential applications in organic electronics, pharmaceuticals, or as intermediates in synthetic chemistry. The molecular structure indicates that it may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the environment in which it is studied. Overall, 1-furan-2-yl-N-(thiophen-3-ylmethyl)methanamine represents a versatile structure with potential applications in various fields of chemistry.
Formula:C10H11NOS
InChI:InChI=1/C10H11NOS/c1-2-10(12-4-1)7-11-6-9-3-5-13-8-9/h1-5,8,11H,6-7H2
SMILES:c1cc(CNCc2ccsc2)oc1
Synonyms:- 1-(2-Furyl)-N-(3-thienylmethyl)methanamine
- 2-furanmethanamine, N-(3-thienylmethyl)-
- N-(2-furylmethyl)-N-(thien-3-ylmethyl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
