CAS 892596-78-0

N-(4-fluorobenzyl)prop-2-yn-1-amine

Description:

N-(4-fluorobenzyl)prop-2-yn-1-amine is an organic compound characterized by its unique structure, which includes a prop-2-yn-1-amine backbone substituted with a 4-fluorobenzyl group. This compound features a triple bond (alkyne) at the second carbon position, contributing to its reactivity and potential applications in organic synthesis. The presence of the fluorine atom on the benzyl ring enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The amine functional group indicates that it can participate in hydrogen bonding, which may affect its solubility and interaction with other molecules. Additionally, the compound's molecular structure suggests potential uses in pharmaceuticals, particularly in the development of new therapeutic agents. Its CAS number, 892596-78-0, allows for easy identification and reference in chemical databases. Overall, N-(4-fluorobenzyl)prop-2-yn-1-amine is a compound with distinctive chemical properties that may be explored for various applications in research and industry.

Formula: C₁₀H₁₀FN

InChI: InChI=1/C10H10FN/c1-2-7-12-8-9-3-5-10(11)6-4-9/h1,3-6,12H,7-8H2

SMILES: C#CCNCc1ccc(cc1)F

Synonyms:

• benzenemethanamine, 4-fluoro-N-2-propyn-1-yl-

(4-Fluoro-benzyl)-prop-2-ynyl-amine

CAS: 892596-78-0

Formula: C₁₀H₁₀FN

Purity: 95%

Color and Shape: Liquid

Molecular weight: 163.1915

Ref: IN-DA0041R5