CAS 89260-46-8
:3-(1H-Pyrazol-3-yl)benzenamine
Description:
3-(1H-Pyrazol-3-yl)benzenamine, with the CAS number 89260-46-8, is an organic compound characterized by the presence of both a pyrazole and an aniline functional group. This compound features a pyrazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms, attached to a benzene ring that is further substituted with an amino group (-NH2). The presence of the amino group contributes to its potential as a building block in pharmaceuticals and agrochemicals, as it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound may exhibit interesting biological activities due to the combination of the aromatic and heterocyclic components, making it a subject of interest in medicinal chemistry. Additionally, its solubility and reactivity can be influenced by the functional groups present, which may affect its applications in synthesis and material science. Overall, 3-(1H-Pyrazol-3-yl)benzenamine is a versatile compound with potential utility in various chemical and biological contexts.
Formula:C9H9N3
InChI:InChI=1S/C9H9N3/c10-8-3-1-2-7(6-8)9-4-5-11-12-9/h1-6H,10H2,(H,11,12)
InChI key:InChIKey=SXPNWQIDNWGAEB-UHFFFAOYSA-N
SMILES:NC=1C=C(C=CC1)C=2C=CNN2
Synonyms:- 3-(1H-Pyrazol-3-yl)aniline
- 3-(1H-Pyrazol-3-yl)benzenamine
- 3-(3-Aminophenyl)-1H-pyrazole
- 3-(3-Aminophenyl)pyrazole
- benzenamine, 3-(1H-pyrazol-3-yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(1H-Pyrazol-3-yl)aniline
CAS:Formula:C9H9N3Purity:96%Color and Shape:SolidMolecular weight:159.18793-(1H-Pyrazol-3-yl)aniline
CAS:3-(1H-Pyrazol-3-yl)anilineFormula:C9H9N3Purity:98%Color and Shape: yellow solidMolecular weight:159.19g/mol3-(1H-Pyrazol-3-yl)aniline
CAS:3-(1H-Pyrazol-3-yl)aniline is a protonated form of fentanyl that interacts with the opioid receptors in the body. It is used as an analgesic, but also has a high risk for abuse and addiction. The drug is not considered to be a controlled substance according to the Controlled Substances Act. 3-(1H-Pyrazol-3-yl)aniline is a synthetic compound that does not have any major side effects other than respiratory depression, which can be reversed with naloxone. This drug has been found to have long lasting effects, making it suitable for chronic pain management. 3-(1H-Pyrazol-3-yl)aniline binds to the endocyclic nitrogen atom on the phenyl ring of fentanyl and causes ionization in water, which may lead to its long lasting effects. 3-(1H-Pyrazol-3-yl)aniline can be administeredFormula:C9H9N3Purity:Min. 95%Molecular weight:159.19 g/mol



