CAS 89260-47-9
:4-(5-Bromo-1H-imidazol-4-yl)benzenamine
Description:
4-(5-Bromo-1H-imidazol-4-yl)benzenamine, with the CAS number 89260-47-9, is an organic compound characterized by its structure, which features a brominated imidazole ring attached to a phenylamine moiety. This compound typically exhibits properties associated with both aromatic amines and heterocyclic compounds. The presence of the bromine atom enhances its reactivity and can influence its solubility in various solvents. It may participate in electrophilic substitution reactions due to the electron-donating nature of the amine group and the electron-withdrawing effect of the bromine. Additionally, the imidazole ring contributes to potential biological activity, making it of interest in medicinal chemistry. The compound's physical properties, such as melting point and solubility, can vary depending on the specific conditions and purity. Overall, 4-(5-Bromo-1H-imidazol-4-yl)benzenamine is a versatile compound with potential applications in pharmaceuticals and materials science, particularly in the development of new drugs or as a building block in organic synthesis.
Formula:C9H8BrN3
InChI:InChI=1S/C9H8BrN3/c10-9-8(12-5-13-9)6-1-3-7(11)4-2-6/h1-5H,11H2,(H,12,13)
InChI key:InChIKey=ALDUJKPZUHQTNT-UHFFFAOYSA-N
SMILES:BrC1=C(NC=N1)C2=CC=C(N)C=C2
Synonyms:- Benzenamine, 4-(5-bromo-1H-imidazol-4-yl)-
- 4-(5-Bromo-1H-imidazol-4-yl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
