CAS 89260-51-5
:2-(Chloromethyl)-5-(3-nitrophenyl)furan
Description:
2-(Chloromethyl)-5-(3-nitrophenyl)furan is an organic compound characterized by its furan ring, which is a five-membered aromatic heterocycle containing one oxygen atom. The presence of a chloromethyl group (-CH2Cl) at the 2-position and a nitrophenyl group at the 5-position contributes to its reactivity and potential applications in organic synthesis. This compound typically exhibits a yellow to brown color due to the nitro group, which can influence its electronic properties and reactivity. It is likely to be soluble in organic solvents, reflecting the hydrophobic nature of the furan and phenyl moieties. The chloromethyl group can serve as a reactive site for further chemical modifications, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the nitro group can participate in electrophilic aromatic substitution reactions, enhancing the compound's versatility in synthetic chemistry. Safety precautions should be taken when handling this compound, as both chlorinated and nitro compounds can pose health risks.
Formula:C11H8ClNO3
InChI:InChI=1S/C11H8ClNO3/c12-7-10-4-5-11(16-10)8-2-1-3-9(6-8)13(14)15/h1-6H,7H2
InChI key:InChIKey=FBIWAIILMRFRCG-UHFFFAOYSA-N
SMILES:C(Cl)C=1OC(=CC1)C2=CC(N(=O)=O)=CC=C2
Synonyms:- Furan, 2-(chloromethyl)-5-(3-nitrophenyl)-
- 2-(Chloromethyl)-5-(3-nitrophenyl)furan
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
