CAS 89268-96-2
:hexyl (2E)-2-cyano-3-(methylamino)prop-2-enoate
Description:
Hexyl (2E)-2-cyano-3-(methylamino)prop-2-enoate, with the CAS number 89268-96-2, is an organic compound characterized by its functional groups and structural features. It contains a cyano group (-CN), an ester functional group (due to the hexyl chain and the prop-2-enoate moiety), and a methylamino group (-NH(CH3)-) attached to a prop-2-enoate backbone. This compound is typically a colorless to pale yellow liquid, exhibiting moderate solubility in organic solvents. Its molecular structure suggests potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the cyano group may impart specific reactivity, making it useful in various chemical transformations. Additionally, the hexyl group contributes to its hydrophobic characteristics, influencing its behavior in biological systems and its interaction with other chemical entities. Safety data should be consulted for handling and storage, as compounds with similar structures may exhibit toxicity or environmental hazards.
Formula:C11H18N2O2
InChI:InChI=1/C11H18N2O2/c1-3-4-5-6-7-15-11(14)10(8-12)9-13-2/h9,13H,3-7H2,1-2H3/b10-9+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
