CAS 892691-05-3
:oxo(2-phenylindolizin-3-yl)acetic acid
Description:
Oxo(2-phenylindolizin-3-yl)acetic acid is a chemical compound characterized by its unique structure, which includes an indolizin ring fused with a phenyl group and an acetic acid moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the oxo group suggests that it may participate in various chemical reactions, such as nucleophilic attacks or coordination with metal ions. The phenyl group can enhance the compound's lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the acetic acid functional group may impart acidic properties, allowing for interactions with biological targets. Overall, the structural features of oxo(2-phenylindolizin-3-yl)acetic acid suggest it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C16H11NO3
InChI:InChI=1/C16H11NO3/c18-15(16(19)20)14-13(11-6-2-1-3-7-11)10-12-8-4-5-9-17(12)14/h1-10H,(H,19,20)
SMILES:c1ccc(cc1)c1cc2ccccn2c1C(=O)C(=O)O
Synonyms:- 3-Indolizineacetic Acid, Α-Oxo-2-Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
