CAS 89270-12-2

Methyl 3-methyl-5-propyl-1H-pyrazole-4-carboxylate

Description:

Methyl 3-methyl-5-propyl-1H-pyrazole-4-carboxylate, identified by its CAS number 89270-12-2, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in various chemical reactions. The presence of methyl and propyl substituents on the pyrazole ring influences its physical and chemical properties, such as solubility and boiling point. Methyl 3-methyl-5-propyl-1H-pyrazole-4-carboxylate is often studied for its potential use in agrochemicals, pharmaceuticals, and as a building block in organic synthesis. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health or environmental risks.

Formula: C₉H₁₄N₂O₂

InChI: InChI=1S/C9H14N2O2/c1-4-5-7-8(9(12)13-3)6(2)10-11-7/h4-5H2,1-3H3,(H,10,11)

InChI key: InChIKey=ABNXXHLFBMXERG-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(CCC)NN=C1C

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 3-methyl-5-propyl-, methyl ester
• Methyl 3-methyl-5-propyl-1H-pyrazole-4-carboxylate

1H-Pyrazole-4-carboxylic acid, 3-methyl-5-propyl-, methyl ester

CAS: 89270-12-2

Formula: C₉H₁₄N₂O₂

Molecular weight: 182.2197

Ref: IN-DA0041C5