CAS 89279-16-3

2-(2,4-Dichlorophenoxy)aniline hydrochloride

Description:

2-(2,4-Dichlorophenoxy)aniline hydrochloride is a chemical compound characterized by its structure, which includes a dichlorophenoxy group attached to an aniline moiety. This compound typically appears as a white to off-white crystalline solid. It is soluble in water and various organic solvents, which makes it useful in different applications, particularly in the field of agrochemicals and pharmaceuticals. The presence of the dichlorophenoxy group imparts specific biological activity, often associated with herbicidal properties. As a hydrochloride salt, it is more stable and easier to handle than its free base form. The compound's molecular structure contributes to its reactivity and interaction with biological systems, making it a subject of interest in research related to environmental science and toxicology. Safety data should be consulted for handling and exposure guidelines, as compounds with similar structures may exhibit toxicity or environmental persistence.

Formula: C₁₂H₁₀Cl₃NO

InChI: InChI=1/C12H9Cl2NO.ClH/c13-8-5-6-11(9(14)7-8)16-12-4-2-1-3-10(12)15;/h1-7H,15H2;1H

SMILES: c1ccc(c(c1)N)Oc1ccc(cc1Cl)Cl.Cl

2-(2,4-Dichlorophenoxy)aniline hydrochloride

CAS: 89279-16-3

Formula: C₁₂H₁₀Cl₃NO

Molecular weight: 290.5729

Ref: IN-DA003EQF

2-(2,4-dichlorophenoxy)aniline hydrochloride

CAS: 89279-16-3

2-(2,4-dichlorophenoxy)aniline hydrochloride

Purity: ≥95%

Molecular weight: 290.57g/mol

Ref: 54-OR28609