CAS 89282-64-4
:2-methoxybutan-1-amine
Description:
2-Methoxybutan-1-amine, with the CAS number 89282-64-4, is an organic compound characterized by the presence of both an amine and an ether functional group. It features a butane backbone with a methoxy group (-OCH3) attached to the second carbon and an amino group (-NH2) at the first carbon. This structure imparts unique properties, including moderate polarity due to the presence of the ether and amine groups, which can influence its solubility in various solvents. The compound is likely to be a colorless to pale yellow liquid at room temperature, with a relatively low boiling point compared to larger amines. Its reactivity is primarily governed by the amine functionality, allowing it to participate in nucleophilic substitution reactions and form hydrogen bonds, which can enhance its interactions with other molecules. 2-Methoxybutan-1-amine may find applications in organic synthesis, pharmaceuticals, and as a potential intermediate in the production of more complex chemical entities. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C5H13NO
InChI:InChI=1/C5H13NO/c1-3-5(4-6)7-2/h5H,3-4,6H2,1-2H3
SMILES:CCC(CN)OC
Synonyms:- 1-Butanamine, 2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.