CAS 89282-65-5
:1-ethoxypropan-2-amine
Description:
1-Ethoxypropan-2-amine, with the CAS number 89282-65-5, is an organic compound characterized by the presence of an ethoxy group and an amine functional group. It typically appears as a colorless to pale yellow liquid with a moderate boiling point and a relatively low vapor pressure, indicating it is a volatile substance. The compound is soluble in water and organic solvents, which enhances its utility in various chemical applications. Its structure includes a propan-2-amine backbone, which contributes to its basicity and potential reactivity with acids to form salts. 1-Ethoxypropan-2-amine may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. It is often utilized in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals, due to its ability to act as a nucleophile in various reactions. Additionally, its ethoxy group can influence its solubility and reactivity, making it a versatile compound in chemical research and industrial applications.
Formula:C5H13NO
InChI:InChI=1/C5H13NO/c1-3-7-4-5(2)6/h5H,3-4,6H2,1-2H3
SMILES:CCOCC(C)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.