CAS 89283-48-7

4-Chloro-6-methylthiopyrimidine

Description:

4-Chloro-6-methylthiopyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom at the 4-position and a methylthio group at the 6-position. This compound typically appears as a solid and is known for its role in various chemical syntheses and as an intermediate in the production of pharmaceuticals and agrochemicals. Its molecular structure contributes to its reactivity, making it a valuable building block in organic synthesis. The presence of the chlorine atom enhances its electrophilic character, while the methylthio group can participate in nucleophilic substitution reactions. 4-Chloro-6-methylthiopyrimidine is soluble in organic solvents, and its properties can be influenced by the surrounding environment, such as pH and temperature. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, this compound is significant in medicinal chemistry and material science, showcasing the diverse applications of pyrimidine derivatives.

Formula: C₅H₅ClN₂S

InChI: InChI=1/C5H5ClN2S/c1-9-5-2-4(6)7-3-8-5/h2-3H,1H3

SMILES: CSc1cc(Cl)ncn1

Synonyms:

• 4-Chloro-6-(methylsulfanyl)pyrimidine
• Pyrimidine, 4-chloro-6-(methylthio)-

4-Chloro-6-methylthiopyrimidine

CAS: 89283-48-7

Formula: C₅H₅ClN₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 160.6246

Ref: IN-DA003L5P

4-Chloro-6-methylthiopyrimidine

CAS: 89283-48-7

4-Chloro-6-methylthiopyrimidine

Purity: 97%

Molecular weight: 160.62g/mol

Ref: 54-OR960614

4-Chloro-6-methylthiopyrimidine

CAS: 89283-48-7

Formula: C₅H₅ClN₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 160.62

Ref: 10-F076470