CAS 89283-92-1

5-Bromo-4-chloro-3-pyridinamine

Description:

5-Bromo-4-chloro-3-pyridinamine, with the CAS number 89283-92-1, is an organic compound that belongs to the class of pyridine derivatives. It features a pyridine ring substituted with both bromine and chlorine atoms, as well as an amino group. This compound is characterized by its heterocyclic structure, which contributes to its potential reactivity and biological activity. The presence of halogen substituents (bromine and chlorine) can influence its chemical properties, such as polarity and solubility, making it useful in various synthetic applications. Additionally, the amino group can participate in hydrogen bonding and may enhance the compound's interaction with biological targets, suggesting potential applications in pharmaceuticals or agrochemicals. The compound's stability and reactivity can be affected by environmental conditions, such as pH and temperature. Overall, 5-Bromo-4-chloro-3-pyridinamine is a versatile compound with significant implications in chemical research and development.

Formula: C₅H₄BrClN₂

InChI: InChI=1S/C5H4BrClN2/c6-3-1-9-2-4(8)5(3)7/h1-2H,8H2

SMILES: c1c(c(c(cn1)N)Cl)Br

Synonyms:

• 3-aMino-5-broMo-4-chloropyridine

5-Bromo-4-chloropyridin-3-amine

CAS: 89283-92-1

Formula: C₅H₄BrClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 207.4557

Ref: IN-DA0040ZU

5-Bromo-4-chloropyridin-3-amine

CAS: 89283-92-1

5-Bromo-4-chloropyridin-3-amine

Purity: 97%

Molecular weight: 207.46g/mol

Ref: 54-OR90284

5-Bromo-4-chloropyridin-3-amine

CAS: 89283-92-1

Formula: C₅H₄BrClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 207.46

Ref: 10-F214817