CAS 89284-16-2
:2,5-Dibromo-3-methylfuran
Description:
2,5-Dibromo-3-methylfuran is a heterocyclic organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. The presence of two bromine substituents at the 2 and 5 positions, along with a methyl group at the 3 position, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the electrophilic nature of the bromine atoms, making it useful in various synthetic applications, including organic synthesis and medicinal chemistry. The compound may exhibit moderate to low solubility in water but is generally soluble in organic solvents. Safety considerations are important, as brominated compounds can be hazardous; thus, appropriate handling and storage protocols should be followed. Additionally, its potential applications in pharmaceuticals and agrochemicals make it a subject of interest in research and development.
Formula:C5H4Br2O
InChI:InChI=1/C5H4Br2O/c1-3-2-4(6)8-5(3)7/h2H,1H3
SMILES:Cc1cc(Br)oc1Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
