CAS 892874-27-0

[3-(thiophen-2-ylmethyl)-5-thioxo-1,5-dihydro-4H-1,2,4-triazol-4-yl]acetic acid

Description:

The chemical substance known as [3-(thiophen-2-ylmethyl)-5-thioxo-1,5-dihydro-4H-1,2,4-triazol-4-yl]acetic acid, with the CAS number 892874-27-0, is a heterocyclic compound featuring a triazole ring, which is characterized by its five-membered structure containing three nitrogen atoms. This compound exhibits thioxo functionality, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The thiophenyl group attached to the triazole enhances its aromatic character and may influence its solubility and interaction with biological targets. The acetic acid moiety suggests that the compound can participate in acid-base reactions, potentially acting as a weak acid. Overall, this compound may possess interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its unique structural features could lead to diverse applications, particularly in the fields of agrochemicals or pharmaceuticals, where triazole derivatives are often explored for their antifungal and antibacterial activities.

Formula: C₉H₉N₃O₂S₂

InChI: InChI=1/C9H9N3O2S2/c13-8(14)5-12-7(10-11-9(12)15)4-6-2-1-3-16-6/h1-3H,4-5H2,(H,11,15)(H,13,14)

SMILES: c1cc(Cc2nnc(n2CC(=O)O)S)sc1

(3-Thiophen-2-ylmethyl-5-thioxo-1,5-dihydro-[1,2,4]triazol-4-yl)-acetic acid

CAS: 892874-27-0

(3-Thiophen-2-ylmethyl-5-thioxo-1,5-dihydro-[1,2,4]triazol-4-yl)-acetic acid

Purity: ≥95%

Molecular weight: 255.32g/mol

Ref: 54-OR309411