CAS 892874-30-5

1,5-Dihydro-5-(methylsulfonyl)-3-phenyl-4H-1,2,4-triazole-4-acetic acid

Description:

1,5-Dihydro-5-(methylsulfonyl)-3-phenyl-4H-1,2,4-triazole-4-acetic acid, with the CAS number 892874-30-5, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a methylsulfonyl group, contributing to its potential solubility and reactivity. The presence of the phenyl group enhances its aromatic characteristics, which can influence its interactions and stability. As an acetic acid derivative, it possesses acidic properties, which may affect its behavior in biological systems or chemical reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a unique structure that could have various applications in medicinal chemistry and related fields.

Formula: C₁₁H₁₃N₃O₄S

InChI: InChI=1S/C11H13N3O4S/c1-19(17,18)11-13-12-10(14(11)7-9(15)16)8-5-3-2-4-6-8/h2-6,11,13H,7H2,1H3,(H,15,16)

InChI key: InChIKey=WBVFNELXNSESCK-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C(=NNC1S(C)(=O)=O)C2=CC=CC=C2

Synonyms:

• 4H-1,2,4-Triazole-4-acetic acid, 1,5-dihydro-5-(methylsulfonyl)-3-phenyl-
• 1,5-Dihydro-5-(methylsulfonyl)-3-phenyl-4H-1,2,4-triazole-4-acetic acid

2-(5-Methanesulfonyl-3-phenyl-[1,2,4]triazol-4-yl)-acetic acid

CAS: 892874-30-5

Formula: C₁₁H₁₁N₃O₄S

Molecular weight: 281.2877

Ref: IN-DA0040NY

2-(5-Methanesulfonyl-3-phenyl-[1,2,4]triazol-4-yl)-acetic acid

CAS: 892874-30-5

2-(5-Methanesulfonyl-3-phenyl-[1,2,4]triazol-4-yl)-acetic acid

Purity: ≥95%

Molecular weight: 281.29g/mol

Ref: 54-OR309412