CAS 892874-49-6

7-Chloroquinoline-3-carboxylic acid

Description:

7-Chloroquinoline-3-carboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a chlorine substituent at the 7-position and a carboxylic acid functional group at the 3-position, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals, including antimicrobial and anti-inflammatory properties. Its unique structure allows for various chemical modifications, which can enhance its biological efficacy. Safety data should be consulted for handling, as with many chemical substances, it may pose health risks if not managed properly. Overall, 7-Chloroquinoline-3-carboxylic acid represents a valuable compound in the field of organic chemistry and drug development.

Formula: C₁₀H₆ClNO₂

InChI: InChI=1/C10H6ClNO2/c11-8-2-1-6-3-7(10(13)14)5-12-9(6)4-8/h1-5H,(H,13,14)

SMILES: c1cc(cc2c1cc(cn2)C(=O)O)Cl

Synonyms:

• 3-Quinolinecarboxylic Acid, 7-Chloro-

7-CHLOROQUINOLINE-3-CARBOXYLIC ACID

CAS: 892874-49-6

Formula: C₁₀H₆ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 207.6131

Ref: IN-DA00369Y

7-Chloroquinoline-3-carboxylic acid

CAS: 892874-49-6

7-Chloroquinoline-3-carboxylic acid

Purity: 98%

Molecular weight: 207.61g/mol

Ref: 54-OR307836

7-Chloroquinoline-3-carboxylicacid

CAS: 892874-49-6

7-Chloroquinoline-3-carboxylicacid (7CQCA) is a synthetic compound that has been shown to have regulatory, immunomodulatory, and anticancer properties. It is a potent inhibitor of mammalian DNA polymerase beta and it has been shown to induce apoptosis in human prostate cancer cells by inhibiting the production of cAMP. 7CQCA also inhibits the proliferation of mouse CD1 leukemia cells in vitro and induces apoptosis in these cells. The compound was found to be more effective when used with other agents such as triticum aestivum extract, which may be due to its synergistic interaction with these compounds.

Formula: C₁₀H₆ClNO₂

Purity: Min. 95%

Color and Shape: Off-White Powder

Molecular weight: 207.61 g/mol

Ref: 3D-FC150810

7-Chloroquinoline-3-carboxylic acid

CAS: 892874-49-6

Formula: C₁₀H₆ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 207.61

Ref: 10-F227619