CymitQuimica logo

CAS 892874-68-9

:

Ethyl 6-ethyl-2-methyl-3-quinolinecarboxylate

Description:
Ethyl 6-ethyl-2-methyl-3-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features an ethyl group and a methyl group, contributing to its unique properties and reactivity. It is typically a yellow to brownish liquid or solid, depending on its purity and specific conditions. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic nature, while being less soluble in water. Ethyl 6-ethyl-2-methyl-3-quinolinecarboxylate may possess biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis often involves multi-step organic reactions, and it may serve as an intermediate in the production of other chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound exemplifies the diverse chemistry associated with quinoline derivatives.
Formula:C15H17NO2
InChI:InChI=1S/C15H17NO2/c1-4-11-6-7-14-12(8-11)9-13(10(3)16-14)15(17)18-5-2/h6-9H,4-5H2,1-3H3
InChI key:InChIKey=ZCSLMAZHOOCIJE-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC2=C(N=C1C)C=CC(CC)=C2
Synonyms:
  • 3-Quinolinecarboxylic acid, 6-ethyl-2-methyl-, ethyl ester
  • Ethyl 6-ethyl-2-methyl-3-quinolinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.