CAS 892874-70-3
:6-fluoroquinoline-2,3-dicarboxylic acid
Description:
6-Fluoroquinoline-2,3-dicarboxylic acid is a heterocyclic organic compound characterized by a quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a fluorine atom at the 6-position and two carboxylic acid groups at the 2 and 3 positions contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents due to the carboxylic acid functional groups. It may exhibit acidic behavior, allowing it to participate in various chemical reactions, such as esterification or amidation. The fluorine substituent can influence the compound's electronic properties, potentially enhancing its reactivity or biological activity. Compounds of this type are often studied for their potential applications in pharmaceuticals, particularly as antibacterial or anticancer agents, due to the biological significance of quinoline derivatives. Additionally, the presence of multiple functional groups allows for further derivatization, making it a versatile building block in organic synthesis.
Formula:C11H6FNO4
InChI:InChI=1/C11H6FNO4/c12-6-1-2-8-5(3-6)4-7(10(14)15)9(13-8)11(16)17/h1-4H,(H,14,15)(H,16,17)
SMILES:c1cc2c(cc1F)cc(c(C(=O)O)n2)C(=O)O
Synonyms:- 2,3-Quinolinedicarboxylic Acid, 6-Fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.