CymitQuimica logo

CAS 892874-73-6

:

8-Methyl-2,3-quinolinedicarboxylic acid

Description:
8-Methyl-2,3-quinolinedicarboxylic acid is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features two carboxylic acid groups (-COOH) at the 2 and 3 positions, along with a methyl group (-CH3) at the 8 position of the quinoline ring. The presence of these functional groups contributes to its acidic properties and potential for forming hydrogen bonds, which can influence its solubility and reactivity. Typically, quinoline derivatives exhibit interesting biological activities, including antimicrobial and anticancer properties, making them of interest in medicinal chemistry. The compound may also participate in various chemical reactions, such as esterification or amidation, due to its carboxylic acid groups. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science. As with many organic compounds, the specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable databases.
Formula:C12H9NO4
InChI:InChI=1S/C12H9NO4/c1-6-3-2-4-7-5-8(11(14)15)10(12(16)17)13-9(6)7/h2-5H,1H3,(H,14,15)(H,16,17)
InChI key:InChIKey=IHRBRFOKZGICCR-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=C(C(O)=O)C(C(O)=O)=N2)C=CC1
Synonyms:
  • 2,3-Quinolinedicarboxylic acid, 8-methyl-
  • 8-Methyl-2,3-quinolinedicarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.