CAS 892874-85-0
:2,6,7-trimethylquinoline-3-carboxylic acid
Description:
2,6,7-Trimethylquinoline-3-carboxylic acid is an organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a nitrogen atom. This compound features three methyl groups at the 2, 6, and 7 positions of the quinoline ring, contributing to its unique chemical properties and potential biological activity. The presence of a carboxylic acid functional group at the 3-position enhances its polarity and solubility in polar solvents, making it suitable for various chemical reactions and applications. Its structure suggests potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The compound may exhibit interesting biological activities, including antimicrobial or anti-inflammatory properties, although specific studies would be necessary to confirm these effects. Additionally, its stability and reactivity can be influenced by the presence of the methyl groups and the carboxylic acid, which may participate in hydrogen bonding and other interactions in different environments. Overall, 2,6,7-trimethylquinoline-3-carboxylic acid represents a versatile compound with potential utility in various fields of chemistry and biochemistry.
Formula:C13H13NO2
InChI:InChI=1/C13H13NO2/c1-7-4-10-6-11(13(15)16)9(3)14-12(10)5-8(7)2/h4-6H,1-3H3,(H,15,16)
Synonyms:- 3-quinolinecarboxylic acid, 2,6,7-trimethyl-
- 2,6,7-Trimethylquinoline-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
