CAS 892878-61-4

4-[[(1-Methylethyl)sulfonyl]amino]benzoic acid

Description:

4-[[(1-Methylethyl)sulfonyl]amino]benzoic acid, also known by its CAS number 892878-61-4, is an organic compound characterized by its sulfonamide functional group and a carboxylic acid moiety. This compound features a benzoic acid backbone substituted with a sulfonylamino group, which enhances its solubility and reactivity. It typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the sulfonamide and carboxylic acid groups. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific pathways. Its structure suggests potential interactions with biological macromolecules, which could be explored for therapeutic applications. Additionally, the presence of the isopropyl group contributes to its steric properties, influencing its reactivity and interaction with other chemical species. Overall, 4-[[(1-Methylethyl)sulfonyl]amino]benzoic acid is a compound of interest in both synthetic and medicinal chemistry.

Formula: C₁₀H₁₃NO₄S

InChI: InChI=1S/C10H13NO4S/c1-7(2)16(14,15)11-9-5-3-8(4-6-9)10(12)13/h3-7,11H,1-2H3,(H,12,13)

InChI key: InChIKey=YSHCMQHKKPQZHE-UHFFFAOYSA-N

SMILES: N(S(C(C)C)(=O)=O)C1=CC=C(C(O)=O)C=C1

Synonyms:

• Benzoic acid, 4-[[(1-methylethyl)sulfonyl]amino]-
• 4-[[(1-Methylethyl)sulfonyl]amino]benzoic acid

4-(Propane-2-sulfonamido)benzoic acid

CAS: 892878-61-4

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO₄S

Purity: Min. 95%

Molecular weight: 243.28 g/mol

Ref: 3D-SKB87861