CAS 89291-24-7

Boronic acid, [2-[(acetylmethylamino)methyl]phenyl]-

Description:

Boronic acid, specifically 2-[(acetylmethylamino)methyl]phenyl- (CAS 89291-24-7), is an organic compound characterized by the presence of a boronic acid functional group (-B(OH)2) attached to a phenyl ring. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents like water and alcohols due to the presence of the boronic acid moiety. The acetylmethylamino group enhances its reactivity and potential for forming complexes with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. Boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, this compound may exhibit biological activity, potentially serving as a building block in drug development or as a tool in biochemical research. Its stability and reactivity can be influenced by pH and the presence of other functional groups, making it a versatile compound in both laboratory and industrial settings.

Formula: C₁₀H₁₄BNO₃

InChI: InChI=1S/C10H14BNO3/c1-8(13)12(2)7-9-5-3-4-6-10(9)11(14)15/h3-6,14-15H,7H2,1-2H3

InChI key: InChIKey=LLPLMHPUEGWUQT-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(CN(C(C)=O)C)C=CC=C1

Synonyms:

• [2-[(N-Methylacetamido)methyl]phenyl]boronic acid
• Boronic acid, [2-[(acetylmethylamino)methyl]phenyl]-

Boronic acid, [2-[(acetylmethylamino)methyl]phenyl]-

CAS: 89291-24-7

Formula: C₁₀H₁₄BNO₃

Molecular weight: 207.0341

Ref: IN-DA0087FK