CAS 89292-80-8

3-Bromo-N,N-dimethyl-4-(1-piperazinylmethyl)benzenamine

Description:

3-Bromo-N,N-dimethyl-4-(1-piperazinylmethyl)benzenamine is a chemical compound characterized by its complex structure, which includes a bromine atom, a dimethylamino group, and a piperazinylmethyl substituent attached to a benzene ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the bromine atom may impart specific reactivity, making it useful in synthetic organic chemistry. Additionally, the piperazine moiety can contribute to biological activity, as piperazine derivatives are often explored for their pharmacological properties. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. Its CAS number, 89292-80-8, allows for easy identification and retrieval of information in chemical databases. Overall, this compound represents a unique combination of functional groups that may lead to diverse chemical behavior and potential applications in research and industry.

Formula: C₁₃H₂₀BrN₃

InChI: InChI=1S/C13H20BrN3/c1-16(2)12-4-3-11(13(14)9-12)10-17-7-5-15-6-8-17/h3-4,9,15H,5-8,10H2,1-2H3

InChI key: InChIKey=GLPRAJHPMVXKRZ-UHFFFAOYSA-N

SMILES: C(C1=C(Br)C=C(N(C)C)C=C1)N2CCNCC2

Synonyms:

• 3-Bromo-N,N-dimethyl-4-(1-piperazinylmethyl)benzenamine
• Benzenamine, 3-bromo-N,N-dimethyl-4-(1-piperazinylmethyl)-

Benzenamine, 3-bromo-N,N-dimethyl-4-(1-piperazinylmethyl)-

CAS: 89292-80-8

Formula: C₁₃H₂₀BrN₃

Molecular weight: 298.222

Ref: IN-DA004066