
CAS 893-01-6
:2,6-Bis(2-thienylmethylene)cyclohexanone
Description:
2,6-Bis(2-thienylmethylene)cyclohexanone is an organic compound characterized by its unique structure, which features a cyclohexanone core substituted with two thienylmethylene groups at the 2 and 6 positions. This compound typically exhibits a yellow to orange color and is known for its potential applications in organic synthesis and materials science, particularly in the development of organic light-emitting diodes (OLEDs) and as a dye. The presence of the thienyl groups contributes to its electronic properties, enhancing its ability to absorb light and participate in various chemical reactions. Additionally, the compound may exhibit interesting photophysical properties, such as fluorescence or phosphorescence, depending on its environment and the specific conditions under which it is studied. Its reactivity can be influenced by the presence of functional groups and the steric effects of the cyclohexanone framework, making it a subject of interest in both academic and industrial research. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C16H14OS2
InChI:InChI=1S/C16H14OS2/c17-16-12(10-14-6-2-8-18-14)4-1-5-13(16)11-15-7-3-9-19-15/h2-3,6-11H,1,4-5H2
InChI key:InChIKey=KHXBULXCCPIELT-UHFFFAOYSA-N
SMILES:C(=C1C(=O)C(=CC2=CC=CS2)CCC1)C3=CC=CS3
Synonyms:- 2,6-Bis(2-thienylmethylene)cyclohexanone
- Cyclohexanone, 2,6-bis(2-thienylmethylene)-
- Cyclohexanone, 2,6-di-2-thenylidene-
- 2,6-Bis(2-thenylidene)cyclohexanone
- 2,6-Di-2-thenylidenecyclohexanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
