CAS 89302-15-8
:(5-methoxy-2-nitrophenyl)acetonitrile
Description:
(5-Methoxy-2-nitrophenyl)acetonitrile, with the CAS number 89302-15-8, is an organic compound characterized by its aromatic structure, which includes a methoxy group and a nitro group attached to a phenyl ring. The presence of the methoxy group (-OCH3) enhances the compound's solubility in organic solvents and can influence its reactivity and interaction with other molecules. The nitro group (-NO2) is known for its electron-withdrawing properties, which can affect the compound's electrophilicity and overall chemical behavior. As an acetonitrile derivative, it contains a cyano group (-C≡N), contributing to its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The compound may exhibit various physical properties, such as melting and boiling points, which are influenced by its molecular structure. Additionally, its reactivity can be explored in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a valuable compound in synthetic organic chemistry.
Formula:C9H8N2O3
InChI:InChI=1/C9H8N2O3/c1-14-8-2-3-9(11(12)13)7(6-8)4-5-10/h2-3,6H,4H2,1H3
SMILES:COc1ccc(c(CC#N)c1)N(=O)=O
Synonyms:- 2-Nitro-5-methoxyphenylacetonitrile
- Benzeneacetonitrile, 5-Methoxy-2-Nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(5-Methoxy-2-nitro-phenyl)-acetonitrile
CAS:5-Methoxy-2-nitro-phenyl)-acetonitrile is an analog of β-unsaturated ketones and has been synthesized from phenylmagnesium bromide, amido acid, and α-(chloromethyl)benzene. The reaction was stereoselective with the formation of a single diastereomer. 5-Methoxy-2-nitro-phenyl)-acetonitrile is a chiral compound with two asymmetric carbon atoms. The synthesis of this compound was efficient, requiring only four steps to complete the entire process.
Formula:C9H8N2O3Purity:Min. 95%Molecular weight:192.17 g/mol
