CAS 89307-26-6
:2-(2,2,2-Trifluoroethoxy)-1,3,2-dioxaphospholane
Description:
2-(2,2,2-Trifluoroethoxy)-1,3,2-dioxaphospholane is a chemical compound characterized by its unique structure, which includes a dioxaphospholane ring and a trifluoroethoxy substituent. This compound typically exhibits properties associated with both phosphorus and fluorinated organic compounds, such as potential reactivity in various chemical reactions, including nucleophilic substitutions and hydrolysis. The presence of the trifluoroethoxy group imparts notable hydrophobic characteristics and may enhance the compound's stability and solubility in organic solvents. Additionally, the dioxaphospholane moiety contributes to its potential applications in areas such as organophosphorus chemistry and materials science. The compound may also exhibit interesting biological activities, although specific biological properties would require further investigation. Overall, 2-(2,2,2-Trifluoroethoxy)-1,3,2-dioxaphospholane represents a versatile structure with potential utility in both synthetic and applied chemistry contexts.
Formula:C4H6F3O3P
InChI:InChI=1S/C4H6F3O3P/c5-4(6,7)3-10-11-8-1-2-9-11/h1-3H2
InChI key:InChIKey=RCACIHFKCWUGEJ-UHFFFAOYSA-N
SMILES:O(CC(F)(F)F)P1OCCO1
Synonyms:- 1,3,2-Dioxaphospholane, 2-(2,2,2-trifluoroethoxy)-
- 2-(2,2,2-Trifluoroethoxy)-1,3,2-dioxaphospholane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
