CymitQuimica logo

CAS 89315-56-0

:

Isoquinoline, 5,7-dichloro-1,2,3,4-tetrahydro-

Description:
Isoquinoline, 5,7-dichloro-1,2,3,4-tetrahydro- is a chemical compound that belongs to the isoquinoline family, characterized by a bicyclic structure containing a fused benzene and pyridine ring. This specific compound features two chlorine substituents at the 5 and 7 positions of the isoquinoline framework, which can influence its chemical reactivity and biological activity. The tetrahydro designation indicates that the compound has four hydrogen atoms added to the structure, resulting in a saturated form of the isoquinoline. This saturation can affect its solubility and stability. Isoquinoline derivatives are often studied for their potential pharmacological properties, including antitumor and antimicrobial activities. The presence of chlorine atoms can enhance lipophilicity, potentially affecting the compound's interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed, as halogenated compounds can exhibit varying degrees of toxicity. Overall, this compound's unique structure and substituents make it of interest in both synthetic chemistry and medicinal research.
Formula:C9H9Cl2N
InChI:InChI=1S/C9H9Cl2N/c10-7-3-6-5-12-2-1-8(6)9(11)4-7/h3-4,12H,1-2,5H2
InChI key:QCSLOZFEMQTPJA-UHFFFAOYSA-N
SMILES:C1CNCC2=C1C(=CC(=C2)Cl)Cl
Synonyms:
  • 5,7-Dichloro-1,2,3,4-Tetrahydroisoquinoline
Found 6 products.