CAS 89315-58-2
:Isoquinoline, 6,8-dichloro-1,2,3,4-tetrahydro-
Description:
Isoquinoline, 6,8-dichloro-1,2,3,4-tetrahydro- is a chemical compound that belongs to the isoquinoline family, characterized by a bicyclic structure containing a benzene ring fused to a pyridine ring. This specific compound features two chlorine atoms substituted at the 6 and 8 positions of the isoquinoline framework, contributing to its unique chemical properties. The tetrahydro designation indicates that the compound has undergone partial hydrogenation, resulting in a saturated structure that can influence its reactivity and stability. Isoquinolines are known for their diverse biological activities, and the presence of halogen substituents can enhance their pharmacological profiles. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or antitumor activities, making it of interest in medicinal chemistry. Additionally, its molecular structure can affect solubility, boiling and melting points, and interaction with biological targets. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C9H9Cl2N
InChI:InChI=1S/C9H9Cl2N/c10-7-3-6-1-2-12-5-8(6)9(11)4-7/h3-4,12H,1-2,5H2
InChI key:InChIKey=HRGNUIZWSIKGMT-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC(Cl)=C1)CCNC2
Synonyms:- Isoquinoline, 6,8-dichloro-1,2,3,4-tetrahydro-
- 6,8-Dichloro-1,2,3,4-tetrahydroisoquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
