CAS 89323-10-4
:3-nitrosopyridine-2,6-diamine
Description:
3-Nitrosopyridine-2,6-diamine is an organic compound characterized by its pyridine ring structure, which is substituted with both nitroso and amino groups. The presence of the nitroso group (-NO) introduces unique reactivity, making it a potential candidate for various chemical reactions, including those involving radical species. The amino groups (-NH2) contribute to its basicity and can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific conditions. Its chemical properties allow it to be utilized in synthetic organic chemistry, particularly in the development of dyes, pharmaceuticals, and agrochemicals. Additionally, the compound's reactivity can be influenced by environmental factors such as pH and temperature, which may affect its stability and behavior in different chemical contexts. Safety precautions should be observed when handling this compound due to potential toxicity associated with nitroso compounds.
Formula:C5H6N4O
InChI:InChI=1/C5H6N4O/c6-4-2-1-3(9-10)5(7)8-4/h1-2H,(H4,6,7,8)
SMILES:c1cc(=N)[nH]c(c1N=O)N
Synonyms:- 2,6-Pyridinediamine, 3-Nitroso-
- 3-Nitrosopyridine-2,6-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.