CAS 89329-09-9
:2H-1-Benzopyran-3,5,7-triol, 2-[2,2-bis(4-fluorophenyl)-1,3-benzodioxol-5-yl]-3,4-dihydro-, (2R-trans)-
Description:
The chemical substance known as "2H-1-Benzopyran-3,5,7-triol, 2-[2,2-bis(4-fluorophenyl)-1,3-benzodioxol-5-yl]-3,4-dihydro-, (2R-trans)-" with CAS number 89329-09-9 is a complex organic compound characterized by its polycyclic structure, which includes a benzopyran moiety and a substituted benzodioxole. This compound features multiple functional groups, including hydroxyl (-OH) groups, which contribute to its potential biological activity and solubility properties. The presence of fluorinated phenyl groups may enhance its lipophilicity and influence its interaction with biological targets. The stereochemistry indicated by the (2R-trans) designation suggests specific spatial arrangements of atoms, which can significantly affect the compound's reactivity and biological effects. Such compounds are often studied for their pharmacological properties, including antioxidant, anti-inflammatory, or anticancer activities. Overall, this substance exemplifies the intricate relationship between molecular structure and function in organic chemistry and medicinal applications.
Formula:C28H20F2O6
InChI:InChI=1/C28H20F2O6/c29-18-6-2-16(3-7-18)28(17-4-8-19(30)9-5-17)35-24-10-1-15(11-26(24)36-28)27-23(33)14-21-22(32)12-20(31)13-25(21)34-27/h1-13,23,27,31-33H,14H2/t23-,27+/m0/s1
InChI key:InChIKey=PLNCZRAUVTYXPB-WNCULLNHSA-N
SMILES:FC1=CC=C(C2(OC=3C(O2)=CC=C(C3)[C@H]4OC=5C(C[C@@H]4O)=C(O)C=C(O)C5)C6=CC=C(F)C=C6)C=C1
Synonyms:- (2R,3S)-2-[2,2-bis(4-fluorophenyl)-1,3-benzodioxol-5-yl]chroman-3,5,7-triol
- 2H-1-Benzopyran-3,5,7-triol, 2-[2,2-bis(4-fluorophenyl)-1,3-benzodioxol-5-yl]-3,4-dihydro-, (2R-trans)-
- (2R-trans)-2-(2,2-Bis(4-fluorophenyl)-1,3-benzodioxol-5-yl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-1-Benzopyran-3,5,7-triol,2-[2,2-bis(4-fluorophenyl)-1,3-benzodioxol-5-yl]-3,4-dihydro-, (2R-trans)-(9CI)
CAS:Formula:C28H20F2O6Molecular weight:490.4516
