
CAS 89329-12-4
:2H-1-Benzopyran-3,5,7-triol, 3,4-dihydro-2-[2-(4-nitrophenyl)-2-phenyl-1,3-benzodioxol-5-yl]-, (2R-trans)-
Description:
The chemical substance known as "2H-1-Benzopyran-3,5,7-triol, 3,4-dihydro-2-[2-(4-nitrophenyl)-2-phenyl-1,3-benzodioxol-5-yl]-, (2R-trans)-" with CAS number 89329-12-4 is a complex organic compound characterized by its polyphenolic structure. It features a benzopyran core, which is a fused ring system containing both benzene and pyran rings, contributing to its potential biological activity. The presence of multiple hydroxyl groups (indicated by "triol") suggests that it may exhibit antioxidant properties, as hydroxyl groups can donate hydrogen atoms to free radicals. Additionally, the compound contains a nitrophenyl substituent, which may influence its electronic properties and reactivity. The stereochemistry indicated by "(2R-trans)-" suggests specific spatial arrangements of atoms, which can significantly affect the compound's interactions and biological efficacy. Overall, this compound may be of interest in medicinal chemistry and pharmacology due to its structural features and potential therapeutic applications.
Formula:C28H21NO8
InChI:InChI=1S/C28H21NO8/c30-20-13-22(31)21-15-23(32)27(35-25(21)14-20)16-6-11-24-26(12-16)37-28(36-24,17-4-2-1-3-5-17)18-7-9-19(10-8-18)29(33)34/h1-14,23,27,30-32H,15H2/t23-,27+,28?/m0/s1
InChI key:InChIKey=TZIOWTSBLLCTJO-QFIHXRDCSA-N
SMILES:N(=O)(=O)C1=CC=C(C2(OC=3C(O2)=CC=C(C3)[C@H]4OC=5C(C[C@@H]4O)=C(O)C=C(O)C5)C6=CC=CC=C6)C=C1
Synonyms:- 2H-1-Benzopyran-3,5,7-triol, 3,4-dihydro-2-[2-(4-nitrophenyl)-2-phenyl-1,3-benzodioxol-5-yl]-, (2R-trans)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-1-Benzopyran-3,5,7-triol,3,4-dihydro-2-[2-(4-nitrophenyl)-2-phenyl-1,3-benzodioxol-5-yl]-, (2R-trans)-(9CI)
CAS:Formula:C28H21NO8Molecular weight:499.4682
