CAS 89331-01-1
:5-nitrotetralin-2-one
Description:
5-Nitrotetralin-2-one is an organic compound characterized by its nitro and ketone functional groups attached to a tetralin structure, which consists of a bicyclic system comprising a six-membered aromatic ring fused to a five-membered cycloalkane. This compound typically exhibits a yellow to brown coloration and is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the nitro group contributes to its reactivity, making it a suitable candidate for further chemical transformations. Additionally, the ketone functionality can participate in various reactions, such as nucleophilic additions. The compound's solubility and stability can vary depending on the solvent and environmental conditions. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental hazards. Overall, 5-nitrotetralin-2-one is a versatile compound with significant implications in chemical research and industrial applications.
Formula:C10H9NO3
InChI:InChI=1/C10H9NO3/c12-8-4-5-9-7(6-8)2-1-3-10(9)11(13)14/h1-3H,4-6H2
SMILES:c1cc2CC(=O)CCc2c(c1)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,4-Dihydro-5-nitro-2(1H)-naphthalenone
CAS:Controlled ProductFormula:C10H9NO3Color and Shape:NeatMolecular weight:191.183

