CAS 89339-61-7
:2-Propenamide, N-propyl-, homopolymer
Description:
2-Propenamide, N-propyl-, homopolymer, also known as poly(N-propylacrylamide), is a synthetic polymer characterized by its hydrophilic properties and ability to form hydrogels. This polymer is derived from the polymerization of N-propylacrylamide monomers, resulting in a structure that exhibits temperature-sensitive behavior, making it useful in various applications, including drug delivery systems and tissue engineering. The polymer's solubility in water and its responsiveness to temperature changes allow it to transition between hydrophilic and hydrophobic states, which is particularly advantageous in biomedical applications. Additionally, it possesses good mechanical properties and biocompatibility, making it suitable for use in medical devices and as a component in cosmetic formulations. The CAS number 89339-61-7 uniquely identifies this substance, facilitating its recognition in scientific literature and regulatory contexts. Overall, 2-Propenamide, N-propyl-, homopolymer is valued for its versatility and functionality in both industrial and research applications.
Formula:(C6H11NO)x
InChI:InChI=1S/C6H11NO/c1-3-5-7-6(8)4-2/h4H,2-3,5H2,1H3,(H,7,8)
InChI key:InChIKey=WDFKEEALECCKTJ-UHFFFAOYSA-N
SMILES:C(NCCC)(C=C)=O
Synonyms:- N-Propylacrylamide homopolymer
- N-n-Propylacrylamide homopolymer
- 2-Propenamide, N-propyl-, homopolymer
- Poly(N-propylacrylamide)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
