
CAS 893424-27-6
:4-(1H-[1,2,4]Triazol-3-yl)-piperidine-1-carboxylic acid benzyl ester
Description:
4-(1H-[1,2,4]Triazol-3-yl)-piperidine-1-carboxylic acid benzyl ester is a chemical compound characterized by its unique structure, which includes a piperidine ring, a triazole moiety, and a benzyl ester functional group. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The triazole ring contributes to its biological activity, often enhancing its interaction with biological targets, making it of interest in medicinal chemistry. The benzyl ester group can influence the compound's lipophilicity and stability, affecting its pharmacokinetic properties. Additionally, the presence of the carboxylic acid functionality may allow for further derivatization or conjugation, expanding its utility in various chemical applications. Overall, this compound's structural features suggest potential applications in drug development, particularly in areas targeting specific biological pathways or mechanisms.
Formula:C15H18N4O2
InChI:InChI=1S/C15H18N4O2/c20-15(21-10-12-4-2-1-3-5-12)19-8-6-13(7-9-19)14-16-11-17-18-14/h1-5,11,13H,6-10H2,(H,16,17,18)
InChI key:InChIKey=ACNBOWAEOFAGKJ-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CCC(CC2)C=3NC=NN3
Synonyms:- Benzyl 4-(1H-1,2,4-triazol-3-yl)piperidine-1-carboxylate
- 4-(1H-[1,2,4]Triazol-3-yl)-piperidine-1-carboxylic acid benzyl ester
- 1-Piperidinecarboxylic acid, 4-(1H-1,2,4-triazol-3-yl)-, phenylmethyl ester
- 1-Piperidinecarboxylic acid, 4-(1H-1,2,4-triazol-5-yl)-, phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.