
CAS 89344-85-4
:5-Butyl-3-chlorodihydro-2(3H)-furanone
Description:
5-Butyl-3-chlorodihydro-2(3H)-furanone, with the CAS number 89344-85-4, is a chemical compound characterized by its furanone structure, which includes a five-membered lactone ring. This compound features a butyl group, contributing to its hydrophobic properties, and a chlorine atom, which can influence its reactivity and potential applications. The presence of the dihydrofuran moiety suggests that it may exhibit interesting chemical behavior, including potential reactivity in nucleophilic substitution reactions due to the electrophilic nature of the carbonyl group. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential biological activity and utility as an intermediate in the synthesis of more complex molecules. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific conditions and purity of the sample. As with any chemical substance, safety precautions should be observed when handling it, considering its potential hazards associated with chlorine and organic compounds.
Formula:C8H13ClO2
InChI:InChI=1S/C8H13ClO2/c1-2-3-4-6-5-7(9)8(10)11-6/h6-7H,2-5H2,1H3
InChI key:InChIKey=JRJNBIWGQOPZJU-UHFFFAOYSA-N
SMILES:C(CCC)C1CC(Cl)C(=O)O1
Synonyms:- 2(3H)-Furanone, 5-butyl-3-chlorodihydro-
- 5-Butyl-3-chlorodihydro-2(3H)-furanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
