
CAS 89346-49-6
:3-(2-Fluorophenyl)pyridine
Description:
3-(2-Fluorophenyl)pyridine is an organic compound characterized by its pyridine ring substituted with a 2-fluorophenyl group at the 3-position. This compound features a heterocyclic aromatic structure, where the pyridine ring contributes to its basicity and potential reactivity. The presence of the fluorine atom on the phenyl ring enhances the compound's electron-withdrawing properties, which can influence its chemical behavior and interactions. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for various potential applications, including in the synthesis of more complex molecules or as intermediates in organic reactions. Additionally, the compound's solubility, stability, and reactivity can vary based on the specific conditions and solvents used. Overall, 3-(2-Fluorophenyl)pyridine represents a versatile building block in organic synthesis and pharmaceutical research.
Formula:C11H8FN
InChI:InChI=1S/C11H8FN/c12-11-6-2-1-5-10(11)9-4-3-7-13-8-9/h1-8H
InChI key:InChIKey=OFVMMLBVGWZEHK-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=CC=NC2)C=CC=C1
Synonyms:- Pyridine, 3-(2-fluorophenyl)-
- 3-(2-Fluorophenyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
