
CAS 89346-50-9
:4-(2-Fluorophenyl)pyridine
Description:
4-(2-Fluorophenyl)pyridine is an organic compound characterized by its pyridine ring substituted with a 2-fluorophenyl group at the 4-position. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water. The presence of the fluorine atom in the phenyl group can influence its electronic properties, potentially enhancing its reactivity and making it useful in various chemical applications, including pharmaceuticals and agrochemicals. The compound may exhibit biological activity, which is often assessed through various assays to determine its potential as a drug candidate. Additionally, its molecular structure allows for interactions with biological targets, making it a subject of interest in medicinal chemistry. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance. Overall, 4-(2-Fluorophenyl)pyridine is a versatile compound with potential applications in research and industry.
Formula:C11H8FN
InChI:InChI=1S/C11H8FN/c12-11-4-2-1-3-10(11)9-5-7-13-8-6-9/h1-8H
InChI key:InChIKey=SVKRUYRFORNEGX-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=CN=CC2)C=CC=C1
Synonyms:- 4-(2-Fluorophenyl)pyridine
- Pyridine, 4-(2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.