
CAS 89352-68-1
:Hexyl (3Z)-3-hexenoate
Description:
Hexyl (3Z)-3-hexenoate, with the CAS number 89352-68-1, is an ester formed from hexanoic acid and (3Z)-3-hexenoic acid. This compound typically exhibits a pleasant fruity odor, making it useful in flavoring and fragrance applications. It is a colorless to pale yellow liquid at room temperature and is generally soluble in organic solvents while having limited solubility in water due to its hydrophobic nature. The presence of a double bond in its structure contributes to its reactivity, particularly in addition reactions. Hexyl (3Z)-3-hexenoate can be synthesized through esterification processes, and its stability can be influenced by factors such as temperature and exposure to light. In terms of safety, like many esters, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, its unique chemical properties and sensory characteristics make it valuable in various industrial applications, particularly in the food and cosmetic industries.
Formula:C12H22O2
InChI:InChI=1S/C12H22O2/c1-3-5-7-9-11-14-12(13)10-8-6-4-2/h6,8H,3-5,7,9-11H2,1-2H3/b8-6-
InChI key:InChIKey=AJRXHGBCTHPGBX-VURMDHGXSA-N
SMILES:C(OCCCCCC)(C/C=C\CC)=O
Synonyms:- Hexyl (3Z)-3-hexenoate
- 3-Hexenoic acid, hexyl ester, (Z)-
- 3-Hexenoic acid, hexyl ester, (3Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
