CAS 89354-45-0
:(1S,3'Z,5a'R,6'S,7a'S)-3'-butylidene-6'-propyl-3',4',5',5a',6,6',7,7a'-octahydro-1'H,3H-spiro[2-benzofuran-1,7'-cyclobuta[e][2]benzofuran]-1',3-dione
Description:
The chemical substance with the name "(1S,3'Z,5a'R,6'S,7a'S)-3'-butylidene-6'-propyl-3',4',5',5a',6,6',7,7a'-octahydro-1'H,3H-spiro[2-benzofuran-1,7'-cyclobuta[e][2]benzofuran]-1',3-dione" and CAS number "89354-45-0" is a complex organic compound characterized by its unique spirocyclic structure, which incorporates multiple fused rings, including benzofuran and cyclobutane moieties. This compound features several stereocenters, contributing to its chiral nature, which can influence its biological activity and interactions. The presence of butylidene and propyl groups suggests potential hydrophobic characteristics, which may affect its solubility and reactivity in various environments. Additionally, the dione functional groups indicate the potential for reactivity typical of carbonyl compounds, such as undergoing nucleophilic addition or condensation reactions. Overall, this compound's intricate structure and functional groups may lend it interesting properties for applications in fields such as medicinal chemistry or materials science, although specific biological or chemical behaviors would require further empirical investigation.
Formula:C24H28O4
InChI:InChI=1/C24H28O4/c1-3-5-11-19-16-13-12-14-17(8-4-2)24(21(14)20(16)23(26)27-19)18-10-7-6-9-15(18)22(25)28-24/h6,9,11,14,17,21H,3-5,7-8,10,12-13H2,1-2H3/b19-11-/t14-,17+,21+,24-/m1/s1
Synonyms:- Riligustilide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Riligustilide
CAS:Riligustilide is a natural compound, which is derived from the root of the Angelica sinensis plant. This plant, commonly known as Dong Quai, is native to China and has been used in traditional medicine for centuries. The mode of action of Riligustilide involves exerting various pharmacological effects, including anti-inflammatory and neuroprotective activities. Its mechanism is thought to involve modulating signaling pathways and inhibiting pro-inflammatory cytokines, though detailed pathways continue to be the subject of ongoing research.Formula:C24H28O4Purity:Min. 95%Molecular weight:380.5 g/mol

