CAS 89356-09-2
:trans-4-(4-Propylcyclohexyl)-4'-pentyl-1,1'-biphenyl
Description:
Trans-4-(4-Propylcyclohexyl)-4'-pentyl-1,1'-biphenyl, identified by its CAS number 89356-09-2, is a chemical compound that belongs to the class of liquid crystals, specifically a type of smectic liquid crystal. This compound features a biphenyl core with substituents that enhance its mesogenic properties, making it suitable for applications in liquid crystal displays (LCDs). Its structure includes a propylcyclohexyl group and a pentyl chain, which contribute to its unique thermal and optical characteristics. Typically, such compounds exhibit a high degree of molecular order and can transition between different phases depending on temperature. The presence of bulky groups in its structure often leads to a lower melting point and a wider temperature range for liquid crystalline behavior. Additionally, the trans configuration of the biphenyl moiety is crucial for maintaining the stability and orientation of the liquid crystal phase. Overall, this compound is of interest in materials science and engineering, particularly in the development of advanced display technologies.
Formula:C26H36
InChI:InChI=1/C26H36/c1-3-5-6-8-22-11-15-24(16-12-22)26-19-17-25(18-20-26)23-13-9-21(7-4-2)10-14-23/h11-12,15-21,23H,3-10,13-14H2,1-2H3/t21-,23-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.