CymitQuimica logo

CAS 893566-49-9

:

3-Methoxy-4-quinolinemethanol

Description:
3-Methoxy-4-quinolinemethanol, identified by its CAS number 893566-49-9, is a chemical compound that features a quinoline structure, which is a bicyclic aromatic compound known for its diverse biological activities. This substance contains a methoxy group (-OCH3) and a hydroxymethyl group (-CH2OH) attached to the quinoline ring, contributing to its potential reactivity and solubility characteristics. The presence of the methoxy group can enhance lipophilicity, while the hydroxymethyl group may provide sites for further chemical modifications or interactions. Compounds of this nature are often studied for their pharmacological properties, including antimicrobial and anticancer activities. The molecular structure suggests that it may participate in hydrogen bonding due to the hydroxymethyl group, influencing its interactions in biological systems. Additionally, the compound's stability, solubility in various solvents, and potential for forming derivatives make it of interest in medicinal chemistry and drug development. However, specific properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C11H11NO2
InChI:InChI=1S/C11H11NO2/c1-14-11-6-12-10-5-3-2-4-8(10)9(11)7-13/h2-6,13H,7H2,1H3
InChI key:InChIKey=BNZNBSCKVCLDMN-UHFFFAOYSA-N
SMILES:C(O)C=1C2=C(N=CC1OC)C=CC=C2
Synonyms:
  • (3-Methoxyquinolin-4-yl)methanol
  • 3-Methoxy-4-quinolinemethanol
  • 4-Quinolinemethanol, 3-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.