
CAS 893566-83-1
:1,1-Dimethylethyl 3,4,6,7-tetrahydro-6-oxo-2,7-naphthyridine-2(1H)-carboxylate
Description:
1,1-Dimethylethyl 3,4,6,7-tetrahydro-6-oxo-2,7-naphthyridine-2(1H)-carboxylate, with the CAS number 893566-83-1, is a chemical compound characterized by its complex bicyclic structure, which includes a naphthyridine moiety. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the dimethyl group enhances its steric bulk, which can influence its interaction with biological targets and its overall pharmacokinetic profile. The tetrahydro-6-oxo configuration indicates that it has a saturated ring system with a carbonyl group, which may play a role in its biological activity. Such compounds are often investigated for their potential therapeutic applications, particularly in medicinal chemistry, due to their structural diversity and ability to interact with various biological pathways. The specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in different environments.
Formula:C13H18N2O3
InChI:InChI=1S/C13H18N2O3/c1-13(2,3)18-12(17)15-5-4-9-6-11(16)14-7-10(9)8-15/h6-7H,4-5,8H2,1-3H3,(H,14,16)
InChI key:InChIKey=PUQPFTREWSPZRE-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC=2C(CC1)=CC(=O)NC2
Synonyms:- 2,7-Naphthyridine-2(1H)-carboxylic acid, 3,4,6,7-tetrahydro-6-oxo-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 3,4,6,7-tetrahydro-6-oxo-2,7-naphthyridine-2(1H)-carboxylate
- tert-Butyl 6-hydroxy-1,2,3,4-tetrahydro-2,7-naphthyridine-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.