CAS 893569-90-9
:3-Bromo-N-2-propen-1-ylbenzenemethanamine
Description:
3-Bromo-N-2-propen-1-ylbenzenemethanamine, identified by its CAS number 893569-90-9, is an organic compound characterized by the presence of a bromine atom, an allyl group (2-propen-1-yl), and an amine functional group attached to a benzene ring. This compound features a substituted benzene structure, which contributes to its potential reactivity and interaction with other chemical species. The bromine atom introduces electrophilic characteristics, making it a useful intermediate in various organic synthesis reactions, including nucleophilic substitutions. The allyl group enhances the compound's reactivity due to its ability to participate in various addition reactions. Additionally, the amine group can engage in hydrogen bonding, influencing the compound's solubility and interaction with biological systems. Overall, 3-Bromo-N-2-propen-1-ylbenzenemethanamine is of interest in medicinal chemistry and materials science, where its unique structural features may be exploited for the development of new pharmaceuticals or functional materials.
Formula:C10H12BrN
InChI:InChI=1S/C10H12BrN/c1-2-6-12-8-9-4-3-5-10(11)7-9/h2-5,7,12H,1,6,8H2
InChI key:InChIKey=GQAFXFFNHAJIOA-UHFFFAOYSA-N
SMILES:C(NCC=C)C1=CC(Br)=CC=C1
Synonyms:- Benzenemethanamine, 3-bromo-N-2-propen-1-yl-
- [(3-Bromophenyl)methyl](prop-2-en-1-yl)amine
- 3-Bromo-N-2-propen-1-ylbenzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
